C9H10ClN5S2 — CID 125351710
1-(2-aminoethyl)-3-(5-chloro-2,1,3-benzothiadiazol-4-yl)thiourea (PubChem CID 125351710) has the molecular formula C9H10ClN5S2 and a molecular weight of 287.80 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3-(5-chloro-2,1,3-benzothiadiazol-4-yl)thiourea.
| Compound Name | 1-(2-aminoethyl)-3-(5-chloro-2,1,3-benzothiadiazol-4-yl)thiourea |
|---|---|
| PubChem CID | 125351710 |
| Molecular Formula | C9H10ClN5S2 |
| Molecular Weight | 287.80 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 1-(2-aminoethyl)-3-(5-chloro-2,1,3-benzothiadiazol-4-yl)thiourea |
| SMILES | NCCNC(=S)Nc1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C9H10ClN5S2/c10-5-1-2-6-8(15-17-14-6)7(5)13-9(16)12-4-3-11/h1-2H,3-4,11H2,(H2,12,13,16) |
| InChIKey | LRKBMCGVKRPPMI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.80 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|