C12H9NO3S2 — CID 18471054
2-[(2-sulfanylidene-1,4-dihydroindeno[1,2-d][1,3]thiazol-6-yl)oxy]acetic acid (PubChem CID 18471054) has the molecular formula C12H9NO3S2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-[(2-sulfanylidene-1,4-dihydroindeno[1,2-d][1,3]thiazol-6-yl)oxy]acetic acid.
| Compound Name | 2-[(2-sulfanylidene-1,4-dihydroindeno[1,2-d][1,3]thiazol-6-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 18471054 |
| Molecular Formula | C12H9NO3S2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | 2-[(2-sulfanylidene-1,4-dihydroindeno[1,2-d][1,3]thiazol-6-yl)oxy]acetic acid |
| SMILES | O=C(O)COc1ccc2c(c1)Cc1sc(=S)[nH]c1-2 |
| InChI | InChI=1S/C12H9NO3S2/c14-10(15)5-16-7-1-2-8-6(3-7)4-9-11(8)13-12(17)18-9/h1-3H,4-5H2,(H,13,17)(H,14,15) |
| InChIKey | QMBJOSHASVKOKA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|