C13H11NO3S2 — CID 18471020
2-[(2-sulfanylidene-4,5-dihydro-1H-benzo[e][1,3]benzothiazol-7-yl)oxy]acetic acid (PubChem CID 18471020) has the molecular formula C13H11NO3S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-[(2-sulfanylidene-4,5-dihydro-1H-benzo[e][1,3]benzothiazol-7-yl)oxy]acetic acid.
| Compound Name | 2-[(2-sulfanylidene-4,5-dihydro-1H-benzo[e][1,3]benzothiazol-7-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 18471020 |
| Molecular Formula | C13H11NO3S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 2-[(2-sulfanylidene-4,5-dihydro-1H-benzo[e][1,3]benzothiazol-7-yl)oxy]acetic acid |
| SMILES | O=C(O)COc1ccc2c(c1)CCc1sc(=S)[nH]c1-2 |
| InChI | InChI=1S/C13H11NO3S2/c15-11(16)6-17-8-2-3-9-7(5-8)1-4-10-12(9)14-13(18)19-10/h2-3,5H,1,4,6H2,(H,14,18)(H,15,16) |
| InChIKey | LJHQUSPYUWMRTP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|