C19H19NO7S — CID 17377204
2-[2-[(7-methoxy-1-methoxycarbonyl-4,5-dihydrobenzo[e][1]benzothiol-2-yl)amino]-2-oxoethoxy]acetic acid (PubChem CID 17377204) has the molecular formula C19H19NO7S and a molecular weight of 405.43 g/mol. Its IUPAC name is 2-[2-[(7-methoxy-1-methoxycarbonyl-4,5-dihydrobenzo[e][1]benzothiol-2-yl)amino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[(7-methoxy-1-methoxycarbonyl-4,5-dihydrobenzo[e][1]benzothiol-2-yl)amino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 17377204 |
| Molecular Formula | C19H19NO7S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 2-[2-[(7-methoxy-1-methoxycarbonyl-4,5-dihydrobenzo[e][1]benzothiol-2-yl)amino]-2-oxoethoxy]acetic acid |
| SMILES | COC(=O)c1c(NC(=O)COCC(=O)O)sc2c1-c1ccc(OC)cc1CC2 |
| InChI | InChI=1S/C19H19NO7S/c1-25-11-4-5-12-10(7-11)3-6-13-16(12)17(19(24)26-2)18(28-13)20-14(21)8-27-9-15(22)23/h4-5,7H,3,6,8-9H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | BYDQPOFZUKGXPN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|