C21H23NO6S — CID 27525323
(3S)-5-[(7-methoxy-1-methoxycarbonyl-4,5-dihydrobenzo[e][1]benzothiol-2-yl)amino]-3-methyl-5-oxopentanoic acid (PubChem CID 27525323) has the molecular formula C21H23NO6S and a molecular weight of 417.48 g/mol. Its IUPAC name is (3S)-5-[(7-methoxy-1-methoxycarbonyl-4,5-dihydrobenzo[e][1]benzothiol-2-yl)amino]-3-methyl-5-oxopentanoic acid.
| Compound Name | (3S)-5-[(7-methoxy-1-methoxycarbonyl-4,5-dihydrobenzo[e][1]benzothiol-2-yl)amino]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 27525323 |
| Molecular Formula | C21H23NO6S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | (3S)-5-[(7-methoxy-1-methoxycarbonyl-4,5-dihydrobenzo[e][1]benzothiol-2-yl)amino]-3-methyl-5-oxopentanoic acid |
| SMILES | COC(=O)c1c(NC(=O)C[C@H](C)CC(=O)O)sc2c1-c1ccc(OC)cc1CC2 |
| InChI | InChI=1S/C21H23NO6S/c1-11(9-17(24)25)8-16(23)22-20-19(21(26)28-3)18-14-6-5-13(27-2)10-12(14)4-7-15(18)29-20/h5-6,10-11H,4,7-9H2,1-3H3,(H,22,23)(H,24,25)/t11-/m0/s1 |
| InChIKey | VZWLXRJSRSOAOM-NSHDSACASA-N |
| XLogP | 3.75 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|