C14H12O3S — CID 83234845
7-methoxy-4,5-dihydrobenzo[e][1]benzothiole-1-carboxylic acid (PubChem CID 83234845) has the molecular formula C14H12O3S and a molecular weight of 260.31 g/mol. Its IUPAC name is 7-methoxy-4,5-dihydrobenzo[e][1]benzothiole-1-carboxylic acid.
| Compound Name | 7-methoxy-4,5-dihydrobenzo[e][1]benzothiole-1-carboxylic acid |
|---|---|
| PubChem CID | 83234845 |
| Molecular Formula | C14H12O3S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 7-methoxy-4,5-dihydrobenzo[e][1]benzothiole-1-carboxylic acid |
| SMILES | COc1ccc2c(c1)CCc1scc(C(=O)O)c1-2 |
| InChI | InChI=1S/C14H12O3S/c1-17-9-3-4-10-8(6-9)2-5-12-13(10)11(7-18-12)14(15)16/h3-4,6-7H,2,5H2,1H3,(H,15,16) |
| InChIKey | ROHYNYVBMMWTIV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |