C13H13O5PS — CID 18472738
2-[hydroxy(thiophen-2-ylmethyl)phosphoryl]oxy-2-phenylacetic acid (PubChem CID 18472738) has the molecular formula C13H13O5PS and a molecular weight of 312.28 g/mol. Its IUPAC name is 2-[hydroxy(thiophen-2-ylmethyl)phosphoryl]oxy-2-phenylacetic acid.
| Compound Name | 2-[hydroxy(thiophen-2-ylmethyl)phosphoryl]oxy-2-phenylacetic acid |
|---|---|
| PubChem CID | 18472738 |
| Molecular Formula | C13H13O5PS |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 2-[hydroxy(thiophen-2-ylmethyl)phosphoryl]oxy-2-phenylacetic acid |
| SMILES | O=C(O)C(OP(=O)(O)Cc1cccs1)c1ccccc1 |
| InChI | InChI=1S/C13H13O5PS/c14-13(15)12(10-5-2-1-3-6-10)18-19(16,17)9-11-7-4-8-20-11/h1-8,12H,9H2,(H,14,15)(H,16,17) |
| InChIKey | SOOJACFQEJQKOR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|