C14H14N2O4S2 — CID 18474185
4-methyl-2-[(4-methylsulfonylbenzoyl)amino]thiophene-3-carboxamide (PubChem CID 18474185) has the molecular formula C14H14N2O4S2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 4-methyl-2-[(4-methylsulfonylbenzoyl)amino]thiophene-3-carboxamide.
| Compound Name | 4-methyl-2-[(4-methylsulfonylbenzoyl)amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 18474185 |
| Molecular Formula | C14H14N2O4S2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 4-methyl-2-[(4-methylsulfonylbenzoyl)amino]thiophene-3-carboxamide |
| SMILES | Cc1csc(NC(=O)c2ccc(S(C)(=O)=O)cc2)c1C(N)=O |
| InChI | InChI=1S/C14H14N2O4S2/c1-8-7-21-14(11(8)12(15)17)16-13(18)9-3-5-10(6-4-9)22(2,19)20/h3-7H,1-2H3,(H2,15,17)(H,16,18) |
| InChIKey | VNDPKBSQFFJKFN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |