C18H23N5O5S — CID 18487834
2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18487834) has the molecular formula C18H23N5O5S and a molecular weight of 421.48 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18487834 |
| Molecular Formula | C18H23N5O5S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | NCC(=O)NCC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C18H23N5O5S/c19-6-15(24)21-8-16(25)22-13(17(26)23-14(9-29)18(27)28)5-10-7-20-12-4-2-1-3-11(10)12/h1-4,7,13-14,20,29H,5-6,8-9,19H2,(H,21,24)(H,22,25)(H,23,26)(H,27,28) |
| InChIKey | DSJNWOMPKUMHQF-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 166.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|