C17H29N9O6 — CID 18488186
2-[[2-[[2-[(2-aminoacetyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18488186) has the molecular formula C17H29N9O6 and a molecular weight of 455.48 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-aminoacetyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18488186 |
| Molecular Formula | C17H29N9O6 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NCC(=O)NC(Cc1cnc[nH]1)C(=O)NC(CO)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C17H29N9O6/c18-5-13(28)24-11(4-9-6-21-8-23-9)14(29)26-12(7-27)15(30)25-10(16(31)32)2-1-3-22-17(19)20/h6,8,10-12,27H,1-5,7,18H2,(H,21,23)(H,24,28)(H,25,30)(H,26,29)(H,31,32)(H4,19,20,22) |
| InChIKey | JLBXTEDABATFTF-UHFFFAOYSA-N |
| XLogP | -4.50 |
| TPSA | 263.93 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | -4.50 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|