C17H24N6O9 — CID 18492693
2-[[2-[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]propanoylamino]-3-carboxypropanoyl]amino]butanedioic acid (PubChem CID 18492693) has the molecular formula C17H24N6O9 and a molecular weight of 456.41 g/mol. Its IUPAC name is 2-[[2-[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]propanoylamino]-3-carboxypropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]propanoylamino]-3-carboxypropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18492693 |
| Molecular Formula | C17H24N6O9 |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 2-[[2-[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]propanoylamino]-3-carboxypropanoyl]amino]butanedioic acid |
| SMILES | CC(NC(=O)C(N)Cc1cnc[nH]1)C(=O)NC(CC(=O)O)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H24N6O9/c1-7(21-15(29)9(18)2-8-5-19-6-20-8)14(28)22-10(3-12(24)25)16(30)23-11(17(31)32)4-13(26)27/h5-7,9-11H,2-4,18H2,1H3,(H,19,20)(H,21,29)(H,22,28)(H,23,30)(H,24,25)(H,26,27)(H,31,32) |
| InChIKey | RUVINFURBJKGIN-UHFFFAOYSA-N |
| XLogP | -3.21 |
| TPSA | 253.90 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |