C24H44N10O5 — CID 18493258
2-[[6-amino-2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-3-methylpentanoic acid (PubChem CID 18493258) has the molecular formula C24H44N10O5 and a molecular weight of 552.68 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18493258 |
| Molecular Formula | C24H44N10O5 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.35 |
| IUPAC Name | 2-[[6-amino-2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCCCN)NC(=O)C(CCCN=C(N)N)NC(=O)C(N)Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C24H44N10O5/c1-3-14(2)19(23(38)39)34-22(37)17(7-4-5-9-25)33-21(36)18(8-6-10-30-24(27)28)32-20(35)16(26)11-15-12-29-13-31-15/h12-14,16-19H,3-11,25-26H2,1-2H3,(H,29,31)(H,32,35)(H,33,36)(H,34,37)(H,38,39)(H4,27,28,30) |
| InChIKey | ASYCMBFDHAODJG-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 269.72 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|