C21H37N7O5S — CID 18494458
2-[[6-amino-2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoyl]amino]-3-methylpentanoic acid (PubChem CID 18494458) has the molecular formula C21H37N7O5S and a molecular weight of 499.64 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18494458 |
| Molecular Formula | C21H37N7O5S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | 2-[[6-amino-2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCCCN)NC(=O)C(CS)NC(=O)C(N)Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C21H37N7O5S/c1-3-12(2)17(21(32)33)28-19(30)15(6-4-5-7-22)26-20(31)16(10-34)27-18(29)14(23)8-13-9-24-11-25-13/h9,11-12,14-17,34H,3-8,10,22-23H2,1-2H3,(H,24,25)(H,26,31)(H,27,29)(H,28,30)(H,32,33) |
| InChIKey | XBERJQZLPXIUEF-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 205.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|