C19H33N7O6S — CID 18494559
6-amino-2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid (PubChem CID 18494559) has the molecular formula C19H33N7O6S and a molecular weight of 487.58 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18494559 |
| Molecular Formula | C19H33N7O6S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 6-amino-2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid |
| SMILES | CC(O)C(NC(=O)C(CS)NC(=O)C(N)Cc1cnc[nH]1)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C19H33N7O6S/c1-10(27)15(18(30)24-13(19(31)32)4-2-3-5-20)26-17(29)14(8-33)25-16(28)12(21)6-11-7-22-9-23-11/h7,9-10,12-15,27,33H,2-6,8,20-21H2,1H3,(H,22,23)(H,24,30)(H,25,28)(H,26,29)(H,31,32) |
| InChIKey | PPFGXEMGKWCRPB-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 225.55 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|