C23H40N10O7 — CID 18494847
5-[[6-amino-1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-1-oxohexan-2-yl]amino]-4-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-oxopentanoic acid (PubChem CID 18494847) has the molecular formula C23H40N10O7 and a molecular weight of 568.64 g/mol. Its IUPAC name is 5-[[6-amino-1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-1-oxohexan-2-yl]amino]-4-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-[[6-amino-1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-1-oxohexan-2-yl]amino]-4-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18494847 |
| Molecular Formula | C23H40N10O7 |
| Molecular Weight | 568.64 g/mol |
| Exact Mass | 568.31 |
| IUPAC Name | 5-[[6-amino-1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-1-oxohexan-2-yl]amino]-4-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-oxopentanoic acid |
| SMILES | NCCCCC(NC(=O)C(CCC(=O)O)NC(=O)C(N)Cc1cnc[nH]1)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C23H40N10O7/c24-8-2-1-4-15(20(37)33-17(22(39)40)5-3-9-29-23(26)27)32-21(38)16(6-7-18(34)35)31-19(36)14(25)10-13-11-28-12-30-13/h11-12,14-17H,1-10,24-25H2,(H,28,30)(H,31,36)(H,32,38)(H,33,37)(H,34,35)(H,39,40)(H4,26,27,29) |
| InChIKey | ALSDFTMLEPNANY-UHFFFAOYSA-N |
| XLogP | -3.13 |
| TPSA | 307.02 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.64 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|