C22H28N6O8 — CID 18498118
2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid (PubChem CID 18498118) has the molecular formula C22H28N6O8 and a molecular weight of 504.50 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18498118 |
| Molecular Formula | C22H28N6O8 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid |
| SMILES | NC(Cc1cnc[nH]1)C(=O)NC(Cc1ccccc1)C(=O)NC(CO)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H28N6O8/c23-14(7-13-9-24-11-25-13)19(32)26-15(6-12-4-2-1-3-5-12)20(33)28-17(10-29)21(34)27-16(22(35)36)8-18(30)31/h1-5,9,11,14-17,29H,6-8,10,23H2,(H,24,25)(H,26,32)(H,27,34)(H,28,33)(H,30,31)(H,35,36) |
| InChIKey | SRFUCQHIFKWPIQ-UHFFFAOYSA-N |
| XLogP | -2.47 |
| TPSA | 236.83 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |