C15H24N6O6S — CID 18499093
2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoyl]amino]acetic acid (PubChem CID 18499093) has the molecular formula C15H24N6O6S and a molecular weight of 416.46 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18499093 |
| Molecular Formula | C15H24N6O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoyl]amino]acetic acid |
| SMILES | CC(O)C(NC(=O)C(N)Cc1cnc[nH]1)C(=O)NC(CS)C(=O)NCC(=O)O |
| InChI | InChI=1S/C15H24N6O6S/c1-7(22)12(21-13(25)9(16)2-8-3-17-6-19-8)15(27)20-10(5-28)14(26)18-4-11(23)24/h3,6-7,9-10,12,22,28H,2,4-5,16H2,1H3,(H,17,19)(H,18,26)(H,20,27)(H,21,25)(H,23,24) |
| InChIKey | LLQZQDRMMORAMP-UHFFFAOYSA-N |
| XLogP | -3.24 |
| TPSA | 199.53 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|