C31H36ClNO3 — CID 18506617
ethyl 2-[2-chloro-6-(dibutylamino)-3-methyl-9H-xanthen-9-yl]benzoate (PubChem CID 18506617) has the molecular formula C31H36ClNO3 and a molecular weight of 506.09 g/mol. Its IUPAC name is ethyl 2-[2-chloro-6-(dibutylamino)-3-methyl-9H-xanthen-9-yl]benzoate.
| Compound Name | ethyl 2-[2-chloro-6-(dibutylamino)-3-methyl-9H-xanthen-9-yl]benzoate |
|---|---|
| PubChem CID | 18506617 |
| Molecular Formula | C31H36ClNO3 |
| Molecular Weight | 506.09 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | ethyl 2-[2-chloro-6-(dibutylamino)-3-methyl-9H-xanthen-9-yl]benzoate |
| SMILES | CCCCN(CCCC)c1ccc2c(c1)Oc1cc(C)c(Cl)cc1C2c1ccccc1C(=O)OCC |
| InChI | InChI=1S/C31H36ClNO3/c1-5-8-16-33(17-9-6-2)22-14-15-25-29(19-22)36-28-18-21(4)27(32)20-26(28)30(25)23-12-10-11-13-24(23)31(34)35-7-3/h10-15,18-20,30H,5-9,16-17H2,1-4H3 |
| InChIKey | YJZYQVIEABHFFP-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.09 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |