C17H22N4O3S — CID 18508167
benzyl N-[1-[4-(hydrazinecarbonyl)-1,3-thiazol-2-yl]-3-methylbutyl]carbamate (PubChem CID 18508167) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is benzyl N-[1-[4-(hydrazinecarbonyl)-1,3-thiazol-2-yl]-3-methylbutyl]carbamate.
| Compound Name | benzyl N-[1-[4-(hydrazinecarbonyl)-1,3-thiazol-2-yl]-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 18508167 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | benzyl N-[1-[4-(hydrazinecarbonyl)-1,3-thiazol-2-yl]-3-methylbutyl]carbamate |
| SMILES | CC(C)CC(NC(=O)OCc1ccccc1)c1nc(C(=O)NN)cs1 |
| InChI | InChI=1S/C17H22N4O3S/c1-11(2)8-13(16-19-14(10-25-16)15(22)21-18)20-17(23)24-9-12-6-4-3-5-7-12/h3-7,10-11,13H,8-9,18H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | JYFRWACBYGROGM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|