About ethyl 2-[2-(pyridin-4-ylmethoxy)phenyl]-1,3-thiazole-4-carboxylate
ethyl 2-[2-(pyridin-4-ylmethoxy)phenyl]-1,3-thiazole-4-carboxylate (PubChem CID 18508186) has the molecular formula C18H16N2O3S
and a molecular weight of 340.40 g/mol. Its IUPAC name is ethyl 2-[2-(pyridin-4-ylmethoxy)phenyl]-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[2-(pyridin-4-ylmethoxy)phenyl]-1,3-thiazole-4-carboxylate |
| PubChem CID | 18508186 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | ethyl 2-[2-(pyridin-4-ylmethoxy)phenyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(-c2ccccc2OCc2ccncc2)n1 |
| InChI | InChI=1S/C18H16N2O3S/c1-2-22-18(21)15-12-24-17(20-15)14-5-3-4-6-16(14)23-11-13-7-9-19-10-8-13/h3-10,12H,2,11H2,1H3 |
| InChIKey | AMMCNUMADVEYTF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[2-(pyridin-4-ylmethoxy)phenyl]-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-(pyridin-4-ylmethoxy)phenyl]-1,3-thiazole-4-carboxylate?
The IUPAC name of ethyl 2-[2-(pyridin-4-ylmethoxy)phenyl]-1,3-thiazole-4-carboxylate (CID 18508186) is ethyl 2-[2-(pyridin-4-ylmethoxy)phenyl]-1,3-thiazole-4-carboxylate.
What is the SMILES notation for ethyl 2-[2-(pyridin-4-ylmethoxy)phenyl]-1,3-thiazole-4-carboxylate?
The canonical SMILES for ethyl 2-[2-(pyridin-4-ylmethoxy)phenyl]-1,3-thiazole-4-carboxylate is CCOC(=O)c1csc(-c2ccccc2OCc2ccncc2)n1.
What is the InChIKey of ethyl 2-[2-(pyridin-4-ylmethoxy)phenyl]-1,3-thiazole-4-carboxylate?
The InChIKey is AMMCNUMADVEYTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O3S/c1-2-22-18(21)15-12-24-17(20-15)14-5-3-4-6-16(14)23-11-13-7-9-19-10-8-13/h3-10,12H,2,11H2,1H3.
What are the key properties of ethyl 2-[2-(pyridin-4-ylmethoxy)phenyl]-1,3-thiazole-4-carboxylate?
ethyl 2-[2-(pyridin-4-ylmethoxy)phenyl]-1,3-thiazole-4-carboxylate has a molecular weight of 340.40 g/mol, XLogP of 3.96, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-(pyridin-4-ylmethoxy)phenyl]-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 18508186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).