C8H13N — CID 18508458
2,3,4,5-tetramethyl-2H-pyrrole (PubChem CID 18508458) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is 2,3,4,5-tetramethyl-2H-pyrrole.
| Compound Name | 2,3,4,5-tetramethyl-2H-pyrrole |
|---|---|
| PubChem CID | 18508458 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | 2,3,4,5-tetramethyl-2H-pyrrole |
| SMILES | CC1=NC(C)C(C)=C1C |
| InChI | InChI=1S/C8H13N/c1-5-6(2)8(4)9-7(5)3/h7H,1-4H3 |
| InChIKey | ANYFIHYZLBPRMB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |