C8H14N+ — CID 21303742
1,3,4,5-tetramethyl-2H-pyrrol-1-ium (PubChem CID 21303742) has the molecular formula C8H14N+ and a molecular weight of 124.21 g/mol. Its IUPAC name is 1,3,4,5-tetramethyl-2H-pyrrol-1-ium.
| Compound Name | 1,3,4,5-tetramethyl-2H-pyrrol-1-ium |
|---|---|
| PubChem CID | 21303742 |
| Molecular Formula | C8H14N+ |
| Molecular Weight | 124.21 g/mol |
| Exact Mass | 124.11 |
| IUPAC Name | 1,3,4,5-tetramethyl-2H-pyrrol-1-ium |
| SMILES | CC1=C(C)C(C)=[N+](C)C1 |
| InChI | InChI=1S/C8H14N/c1-6-5-9(4)8(3)7(6)2/h5H2,1-4H3/q+1 |
| InChIKey | XBEIAWVIQVJZCB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|