About 3,5-dimethyl-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridine
3,5-dimethyl-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridine (PubChem CID 58386446) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 3,5-dimethyl-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridine.
Analyze 3,5-dimethyl-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridine?
The IUPAC name of 3,5-dimethyl-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridine (CID 58386446) is 3,5-dimethyl-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridine.
What is the SMILES notation for 3,5-dimethyl-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridine?
The canonical SMILES for 3,5-dimethyl-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridine is CC1=NCC2=C1CN(C)CC2.
What is the InChIKey of 3,5-dimethyl-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridine?
The InChIKey is FZZITWWYUUZHJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-7-9-6-11(2)4-3-8(9)5-10-7/h3-6H2,1-2H3.
What are the key properties of 3,5-dimethyl-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridine?
3,5-dimethyl-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridine has a molecular weight of 150.22 g/mol, XLogP of 1.09, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridine is sourced from PubChem (CID 58386446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).