C8H13N2P — CID 59107048
(3-methyl-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridin-5-yl)phosphane (PubChem CID 59107048) has the molecular formula C8H13N2P and a molecular weight of 168.18 g/mol. Its IUPAC name is (3-methyl-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridin-5-yl)phosphane.
| Compound Name | (3-methyl-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridin-5-yl)phosphane |
|---|---|
| PubChem CID | 59107048 |
| Molecular Formula | C8H13N2P |
| Molecular Weight | 168.18 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | (3-methyl-1,4,6,7-tetrahydropyrrolo[3,4-c]pyridin-5-yl)phosphane |
| SMILES | CC1=NCC2=C1CN(P)CC2 |
| InChI | InChI=1S/C8H13N2P/c1-6-8-5-10(11)3-2-7(8)4-9-6/h2-5,11H2,1H3 |
| InChIKey | XMDNOKKXIKOSNJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.18 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|