C20H24ClN — CID 18509453
(E)-N-methyl-3-phenyl-N-[(3-prop-1-en-2-ylphenyl)methyl]prop-2-en-1-amine;hydrochloride (PubChem CID 18509453) has the molecular formula C20H24ClN and a molecular weight of 313.87 g/mol. Its IUPAC name is (E)-N-methyl-3-phenyl-N-[(3-prop-1-en-2-ylphenyl)methyl]prop-2-en-1-amine;hydrochloride.
| Compound Name | (E)-N-methyl-3-phenyl-N-[(3-prop-1-en-2-ylphenyl)methyl]prop-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 18509453 |
| Molecular Formula | C20H24ClN |
| Molecular Weight | 313.87 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | (E)-N-methyl-3-phenyl-N-[(3-prop-1-en-2-ylphenyl)methyl]prop-2-en-1-amine;hydrochloride |
| SMILES | C=C(C)c1cccc(CN(C)C/C=C/c2ccccc2)c1.Cl |
| InChI | InChI=1S/C20H23N.ClH/c1-17(2)20-13-7-11-19(15-20)16-21(3)14-8-12-18-9-5-4-6-10-18;/h4-13,15H,1,14,16H2,2-3H3;1H/b12-8+; |
| InChIKey | UJBKUWOJMLQQHM-MXZHIVQLSA-N |
| XLogP | 5.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.87 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |