C28H23N3O3 — CID 18510682
N-[4-[hydroxy(diphenyl)methyl]phenyl]-3-pyridin-3-yl-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 18510682) has the molecular formula C28H23N3O3 and a molecular weight of 449.51 g/mol. Its IUPAC name is N-[4-[hydroxy(diphenyl)methyl]phenyl]-3-pyridin-3-yl-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | N-[4-[hydroxy(diphenyl)methyl]phenyl]-3-pyridin-3-yl-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 18510682 |
| Molecular Formula | C28H23N3O3 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | N-[4-[hydroxy(diphenyl)methyl]phenyl]-3-pyridin-3-yl-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(C(O)(c2ccccc2)c2ccccc2)cc1)C1CC(c2cccnc2)=NO1 |
| InChI | InChI=1S/C28H23N3O3/c32-27(26-18-25(31-34-26)20-8-7-17-29-19-20)30-24-15-13-23(14-16-24)28(33,21-9-3-1-4-10-21)22-11-5-2-6-12-22/h1-17,19,26,33H,18H2,(H,30,32) |
| InChIKey | QLSPGASZGJFAIM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|