C22H18ClN3O2 — CID 69194040
(5S)-N-[4-[chloro(phenyl)methyl]phenyl]-3-pyridin-3-yl-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 69194040) has the molecular formula C22H18ClN3O2 and a molecular weight of 391.86 g/mol. Its IUPAC name is (5S)-N-[4-[chloro(phenyl)methyl]phenyl]-3-pyridin-3-yl-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | (5S)-N-[4-[chloro(phenyl)methyl]phenyl]-3-pyridin-3-yl-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 69194040 |
| Molecular Formula | C22H18ClN3O2 |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (5S)-N-[4-[chloro(phenyl)methyl]phenyl]-3-pyridin-3-yl-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(C(Cl)c2ccccc2)cc1)[C@@H]1CC(c2cccnc2)=NO1 |
| InChI | InChI=1S/C22H18ClN3O2/c23-21(15-5-2-1-3-6-15)16-8-10-18(11-9-16)25-22(27)20-13-19(26-28-20)17-7-4-12-24-14-17/h1-12,14,20-21H,13H2,(H,25,27)/t20-,21?/m0/s1 |
| InChIKey | OJRFZOXIIYGTPG-BGERDNNASA-N |
| XLogP | 4.54 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|