C21H18Br2N2O3 — CID 18512278
N,N-bis[(2-bromophenyl)methyl]-2-methoxy-5-nitroaniline (PubChem CID 18512278) has the molecular formula C21H18Br2N2O3 and a molecular weight of 506.19 g/mol. Its IUPAC name is N,N-bis[(2-bromophenyl)methyl]-2-methoxy-5-nitroaniline.
| Compound Name | N,N-bis[(2-bromophenyl)methyl]-2-methoxy-5-nitroaniline |
|---|---|
| PubChem CID | 18512278 |
| Molecular Formula | C21H18Br2N2O3 |
| Molecular Weight | 506.19 g/mol |
| Exact Mass | 503.97 |
| IUPAC Name | N,N-bis[(2-bromophenyl)methyl]-2-methoxy-5-nitroaniline |
| SMILES | COc1ccc([N+](=O)[O-])cc1N(Cc1ccccc1Br)Cc1ccccc1Br |
| InChI | InChI=1S/C21H18Br2N2O3/c1-28-21-11-10-17(25(26)27)12-20(21)24(13-15-6-2-4-8-18(15)22)14-16-7-3-5-9-19(16)23/h2-12H,13-14H2,1H3 |
| InChIKey | MGXMVAGLGWPWJB-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.19 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|