C14H6Br2Cl2O3P+ — CID 18515171
(2,6-dibromobenzoyl)-(2,6-dichlorobenzoyl)-oxophosphanium (PubChem CID 18515171) has the molecular formula C14H6Br2Cl2O3P+ and a molecular weight of 483.89 g/mol. Its IUPAC name is (2,6-dibromobenzoyl)-(2,6-dichlorobenzoyl)-oxophosphanium.
| Compound Name | (2,6-dibromobenzoyl)-(2,6-dichlorobenzoyl)-oxophosphanium |
|---|---|
| PubChem CID | 18515171 |
| Molecular Formula | C14H6Br2Cl2O3P+ |
| Molecular Weight | 483.89 g/mol |
| Exact Mass | 480.78 |
| IUPAC Name | (2,6-dibromobenzoyl)-(2,6-dichlorobenzoyl)-oxophosphanium |
| SMILES | O=C(c1c(Cl)cccc1Cl)[P+](=O)C(=O)c1c(Br)cccc1Br |
| InChI | InChI=1S/C14H6Br2Cl2O3P/c15-7-3-1-4-8(16)11(7)13(19)22(21)14(20)12-9(17)5-2-6-10(12)18/h1-6H/q+1 |
| InChIKey | KBWUVDVUCQNFCE-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.89 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|