C12H16FNO4 — CID 18520564
N-[2-(2,2-dimethoxyethoxy)-5-fluorophenyl]acetamide (PubChem CID 18520564) has the molecular formula C12H16FNO4 and a molecular weight of 257.26 g/mol. Its IUPAC name is N-[2-(2,2-dimethoxyethoxy)-5-fluorophenyl]acetamide.
| Compound Name | N-[2-(2,2-dimethoxyethoxy)-5-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 18520564 |
| Molecular Formula | C12H16FNO4 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | N-[2-(2,2-dimethoxyethoxy)-5-fluorophenyl]acetamide |
| SMILES | COC(COc1ccc(F)cc1NC(C)=O)OC |
| InChI | InChI=1S/C12H16FNO4/c1-8(15)14-10-6-9(13)4-5-11(10)18-7-12(16-2)17-3/h4-6,12H,7H2,1-3H3,(H,14,15) |
| InChIKey | VDBLYBRVOGCFPL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|