C18H25N3O4 — CID 18521567
5-[4-[2-(2-methylanilino)-2-oxoethyl]piperazin-1-yl]-5-oxopentanoic acid (PubChem CID 18521567) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is 5-[4-[2-(2-methylanilino)-2-oxoethyl]piperazin-1-yl]-5-oxopentanoic acid.
| Compound Name | 5-[4-[2-(2-methylanilino)-2-oxoethyl]piperazin-1-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18521567 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 5-[4-[2-(2-methylanilino)-2-oxoethyl]piperazin-1-yl]-5-oxopentanoic acid |
| SMILES | Cc1ccccc1NC(=O)CN1CCN(C(=O)CCCC(=O)O)CC1 |
| InChI | InChI=1S/C18H25N3O4/c1-14-5-2-3-6-15(14)19-16(22)13-20-9-11-21(12-10-20)17(23)7-4-8-18(24)25/h2-3,5-6H,4,7-13H2,1H3,(H,19,22)(H,24,25) |
| InChIKey | LWIZAGAGLXPFTC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |