C19H32Cl2N4O2 — CID 119833595
N-(2,3-dimethylphenyl)-2-[4-[4-(methylamino)butanoyl]piperazin-1-yl]acetamide;dihydrochloride (PubChem CID 119833595) has the molecular formula C19H32Cl2N4O2 and a molecular weight of 419.40 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[4-[4-(methylamino)butanoyl]piperazin-1-yl]acetamide;dihydrochloride.
| Compound Name | N-(2,3-dimethylphenyl)-2-[4-[4-(methylamino)butanoyl]piperazin-1-yl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119833595 |
| Molecular Formula | C19H32Cl2N4O2 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[4-[4-(methylamino)butanoyl]piperazin-1-yl]acetamide;dihydrochloride |
| SMILES | CNCCCC(=O)N1CCN(CC(=O)Nc2cccc(C)c2C)CC1.Cl.Cl |
| InChI | InChI=1S/C19H30N4O2.2ClH/c1-15-6-4-7-17(16(15)2)21-18(24)14-22-10-12-23(13-11-22)19(25)8-5-9-20-3;;/h4,6-7,20H,5,8-14H2,1-3H3,(H,21,24);2*1H |
| InChIKey | VJXMYMHYCKKNLV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|