C14H25N3O6S — CID 18522687
methyl sulfate;2-(4-nitroanilino)ethyl-pentan-3-ylazanium (PubChem CID 18522687) has the molecular formula C14H25N3O6S and a molecular weight of 363.44 g/mol. Its IUPAC name is methyl sulfate;2-(4-nitroanilino)ethyl-pentan-3-ylazanium.
| Compound Name | methyl sulfate;2-(4-nitroanilino)ethyl-pentan-3-ylazanium |
|---|---|
| PubChem CID | 18522687 |
| Molecular Formula | C14H25N3O6S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | methyl sulfate;2-(4-nitroanilino)ethyl-pentan-3-ylazanium |
| SMILES | CCC(CC)[NH2+]CCNc1ccc([N+](=O)[O-])cc1.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C13H21N3O2.CH4O4S/c1-3-11(4-2)14-9-10-15-12-5-7-13(8-6-12)16(17)18;1-5-6(2,3)4/h5-8,11,14-15H,3-4,9-10H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | AIXQTGVTGLDUJW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 138.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|