C24H26ClN3O6S — CID 18531617
1-(8-chloronaphthalen-1-yl)sulfonyl-4-(4-nitrophenyl)piperazine;1,4-dioxane (PubChem CID 18531617) has the molecular formula C24H26ClN3O6S and a molecular weight of 520.01 g/mol. Its IUPAC name is 1-(8-chloronaphthalen-1-yl)sulfonyl-4-(4-nitrophenyl)piperazine;1,4-dioxane.
| Compound Name | 1-(8-chloronaphthalen-1-yl)sulfonyl-4-(4-nitrophenyl)piperazine;1,4-dioxane |
|---|---|
| PubChem CID | 18531617 |
| Molecular Formula | C24H26ClN3O6S |
| Molecular Weight | 520.01 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | 1-(8-chloronaphthalen-1-yl)sulfonyl-4-(4-nitrophenyl)piperazine;1,4-dioxane |
| SMILES | C1COCCO1.O=[N+]([O-])c1ccc(N2CCN(S(=O)(=O)c3cccc4cccc(Cl)c34)CC2)cc1 |
| InChI | InChI=1S/C20H18ClN3O4S.C4H8O2/c21-18-5-1-3-15-4-2-6-19(20(15)18)29(27,28)23-13-11-22(12-14-23)16-7-9-17(10-8-16)24(25)26;1-2-6-4-3-5-1/h1-10H,11-14H2;1-4H2 |
| InChIKey | RAWVIGJYLVSNAD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.01 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|