C21H20N2O7S2 — CID 18532405
2-[(5E)-5-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylpentanoic acid (PubChem CID 18532405) has the molecular formula C21H20N2O7S2 and a molecular weight of 476.53 g/mol. Its IUPAC name is 2-[(5E)-5-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylpentanoic acid.
| Compound Name | 2-[(5E)-5-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 18532405 |
| Molecular Formula | C21H20N2O7S2 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | 2-[(5E)-5-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylpentanoic acid |
| SMILES | COc1ccc(-c2ccc(/C=C3/SC(=S)N(C(CC(C)C)C(=O)O)C3=O)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H20N2O7S2/c1-11(2)8-16(20(25)26)22-19(24)18(32-21(22)31)10-13-5-7-17(30-13)14-6-4-12(29-3)9-15(14)23(27)28/h4-7,9-11,16H,8H2,1-3H3,(H,25,26)/b18-10+ |
| InChIKey | VGFVLUHLLIEBFX-VCHYOVAHSA-N |
| XLogP | 4.56 |
| TPSA | 123.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|