C18H14N2O7S2 — CID 56725023
2-[(5E)-5-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 56725023) has the molecular formula C18H14N2O7S2 and a molecular weight of 434.45 g/mol. Its IUPAC name is 2-[(5E)-5-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 2-[(5E)-5-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 56725023 |
| Molecular Formula | C18H14N2O7S2 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | 2-[(5E)-5-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | COc1ccc(-c2ccc(/C=C3/SC(=S)N(C(C)C(=O)O)C3=O)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14N2O7S2/c1-9(17(22)23)19-16(21)15(29-18(19)28)8-11-4-6-14(27-11)12-5-3-10(26-2)7-13(12)20(24)25/h3-9H,1-2H3,(H,22,23)/b15-8+ |
| InChIKey | BHFVYCMDWDWDHK-OVCLIPMQSA-N |
| XLogP | 3.54 |
| TPSA | 123.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|