C22H16BrNO5 — CID 18532725
(4E)-4-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-(3,5-dimethoxyphenyl)-1,3-oxazol-5-one (PubChem CID 18532725) has the molecular formula C22H16BrNO5 and a molecular weight of 454.28 g/mol. Its IUPAC name is (4E)-4-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-(3,5-dimethoxyphenyl)-1,3-oxazol-5-one.
| Compound Name | (4E)-4-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-(3,5-dimethoxyphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 18532725 |
| Molecular Formula | C22H16BrNO5 |
| Molecular Weight | 454.28 g/mol |
| Exact Mass | 453.02 |
| IUPAC Name | (4E)-4-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-(3,5-dimethoxyphenyl)-1,3-oxazol-5-one |
| SMILES | COc1cc(OC)cc(C2=N/C(=C/c3ccc(-c4ccc(Br)cc4)o3)C(=O)O2)c1 |
| InChI | InChI=1S/C22H16BrNO5/c1-26-17-9-14(10-18(11-17)27-2)21-24-19(22(25)29-21)12-16-7-8-20(28-16)13-3-5-15(23)6-4-13/h3-12H,1-2H3/b19-12+ |
| InChIKey | BUHWNPBMWGVTCR-XDHOZWIPSA-N |
| XLogP | 5.07 |
| TPSA | 70.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.28 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|