C22H16BrNO4 — CID 2437082
(4Z)-4-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-(4-ethoxyphenyl)-1,3-oxazol-5-one (PubChem CID 2437082) has the molecular formula C22H16BrNO4 and a molecular weight of 438.28 g/mol. Its IUPAC name is (4Z)-4-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-(4-ethoxyphenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-(4-ethoxyphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2437082 |
| Molecular Formula | C22H16BrNO4 |
| Molecular Weight | 438.28 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | (4Z)-4-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-(4-ethoxyphenyl)-1,3-oxazol-5-one |
| SMILES | CCOc1ccc(C2=N/C(=C\c3ccc(-c4ccc(Br)cc4)o3)C(=O)O2)cc1 |
| InChI | InChI=1S/C22H16BrNO4/c1-2-26-17-9-5-15(6-10-17)21-24-19(22(25)28-21)13-18-11-12-20(27-18)14-3-7-16(23)8-4-14/h3-13H,2H2,1H3/b19-13- |
| InChIKey | GNNOQMVAQSNFAB-UYRXBGFRSA-N |
| XLogP | 5.45 |
| TPSA | 61.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.28 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|