C11H19NO — CID 18533269
1-ethenyl-6,6-diethylpiperidin-2-one (PubChem CID 18533269) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-ethenyl-6,6-diethylpiperidin-2-one.
| Compound Name | 1-ethenyl-6,6-diethylpiperidin-2-one |
|---|---|
| PubChem CID | 18533269 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 1-ethenyl-6,6-diethylpiperidin-2-one |
| SMILES | C=CN1C(=O)CCCC1(CC)CC |
| InChI | InChI=1S/C11H19NO/c1-4-11(5-2)9-7-8-10(13)12(11)6-3/h6H,3-5,7-9H2,1-2H3 |
| InChIKey | YEHDUKRVVXGSEE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |