C15H15FN4OS — CID 18534925
N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(6-fluoro-3-pyridinyl)-1,3-thiazole-2-carboxamide (PubChem CID 18534925) has the molecular formula C15H15FN4OS and a molecular weight of 318.38 g/mol. Its IUPAC name is N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(6-fluoro-3-pyridinyl)-1,3-thiazole-2-carboxamide.
| Compound Name | N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(6-fluoro-3-pyridinyl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 18534925 |
| Molecular Formula | C15H15FN4OS |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(6-fluoro-3-pyridinyl)-1,3-thiazole-2-carboxamide |
| SMILES | O=C(NC1CC2CCC1N2)c1ncc(-c2ccc(F)nc2)s1 |
| InChI | InChI=1S/C15H15FN4OS/c16-13-4-1-8(6-17-13)12-7-18-15(22-12)14(21)20-11-5-9-2-3-10(11)19-9/h1,4,6-7,9-11,19H,2-3,5H2,(H,20,21) |
| InChIKey | CCSUTQWORYXLJO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|