C16H16ClN3OS — CID 18535453
N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(6-chloro-3-pyridinyl)thiophene-2-carboxamide (PubChem CID 18535453) has the molecular formula C16H16ClN3OS and a molecular weight of 333.84 g/mol. Its IUPAC name is N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(6-chloro-3-pyridinyl)thiophene-2-carboxamide.
| Compound Name | N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(6-chloro-3-pyridinyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 18535453 |
| Molecular Formula | C16H16ClN3OS |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(6-chloro-3-pyridinyl)thiophene-2-carboxamide |
| SMILES | O=C(NC1CC2CCC1N2)c1ccc(-c2ccc(Cl)nc2)s1 |
| InChI | InChI=1S/C16H16ClN3OS/c17-15-6-1-9(8-18-15)13-4-5-14(22-13)16(21)20-12-7-10-2-3-11(12)19-10/h1,4-6,8,10-12,19H,2-3,7H2,(H,20,21) |
| InChIKey | CBHZUWBHMRUKOG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|