C18H19N3O2S — CID 18535096
N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(4-carbamoylphenyl)thiophene-2-carboxamide (PubChem CID 18535096) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(4-carbamoylphenyl)thiophene-2-carboxamide.
| Compound Name | N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(4-carbamoylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 18535096 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(4-carbamoylphenyl)thiophene-2-carboxamide |
| SMILES | NC(=O)c1ccc(-c2ccc(C(=O)NC3CC4CCC3N4)s2)cc1 |
| InChI | InChI=1S/C18H19N3O2S/c19-17(22)11-3-1-10(2-4-11)15-7-8-16(24-15)18(23)21-14-9-12-5-6-13(14)20-12/h1-4,7-8,12-14,20H,5-6,9H2,(H2,19,22)(H,21,23) |
| InChIKey | IRQLBHQKGUVLOU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |