C18H19N3O2S2 — CID 18535072
N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(3-carbamoylphenyl)sulfanylthiophene-2-carboxamide (PubChem CID 18535072) has the molecular formula C18H19N3O2S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(3-carbamoylphenyl)sulfanylthiophene-2-carboxamide.
| Compound Name | N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(3-carbamoylphenyl)sulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 18535072 |
| Molecular Formula | C18H19N3O2S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(3-carbamoylphenyl)sulfanylthiophene-2-carboxamide |
| SMILES | NC(=O)c1cccc(Sc2ccc(C(=O)NC3CC4CCC3N4)s2)c1 |
| InChI | InChI=1S/C18H19N3O2S2/c19-17(22)10-2-1-3-12(8-10)24-16-7-6-15(25-16)18(23)21-14-9-11-4-5-13(14)20-11/h1-3,6-8,11,13-14,20H,4-5,9H2,(H2,19,22)(H,21,23) |
| InChIKey | UDKAQRQBICWDOE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |