C17H18N2OS2 — CID 18535408
N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-phenylsulfanylthiophene-2-carboxamide (PubChem CID 18535408) has the molecular formula C17H18N2OS2 and a molecular weight of 330.48 g/mol. Its IUPAC name is N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-phenylsulfanylthiophene-2-carboxamide.
| Compound Name | N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-phenylsulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 18535408 |
| Molecular Formula | C17H18N2OS2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-phenylsulfanylthiophene-2-carboxamide |
| SMILES | O=C(NC1CC2CCC1N2)c1ccc(Sc2ccccc2)s1 |
| InChI | InChI=1S/C17H18N2OS2/c20-17(19-14-10-11-6-7-13(14)18-11)15-8-9-16(22-15)21-12-4-2-1-3-5-12/h1-5,8-9,11,13-14,18H,6-7,10H2,(H,19,20) |
| InChIKey | YJHZSRMIUPAREV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |