C18H17N3OS2 — CID 18535393
N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(4-cyanophenyl)sulfanylthiophene-2-carboxamide (PubChem CID 18535393) has the molecular formula C18H17N3OS2 and a molecular weight of 355.49 g/mol. Its IUPAC name is N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(4-cyanophenyl)sulfanylthiophene-2-carboxamide.
| Compound Name | N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(4-cyanophenyl)sulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 18535393 |
| Molecular Formula | C18H17N3OS2 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(4-cyanophenyl)sulfanylthiophene-2-carboxamide |
| SMILES | N#Cc1ccc(Sc2ccc(C(=O)NC3CC4CCC3N4)s2)cc1 |
| InChI | InChI=1S/C18H17N3OS2/c19-10-11-1-4-13(5-2-11)23-17-8-7-16(24-17)18(22)21-15-9-12-3-6-14(15)20-12/h1-2,4-5,7-8,12,14-15,20H,3,6,9H2,(H,21,22) |
| InChIKey | PVSRPCQMBPSQTO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |