C17H18N2S2 — CID 15967029
N-[(1S,2R,4S)-7-azabicyclo[2.2.1]heptan-2-yl]-5-phenylthiophene-2-carbothioamide (PubChem CID 15967029) has the molecular formula C17H18N2S2 and a molecular weight of 314.48 g/mol. Its IUPAC name is N-[(1S,2R,4S)-7-azabicyclo[2.2.1]heptan-2-yl]-5-phenylthiophene-2-carbothioamide.
| Compound Name | N-[(1S,2R,4S)-7-azabicyclo[2.2.1]heptan-2-yl]-5-phenylthiophene-2-carbothioamide |
|---|---|
| PubChem CID | 15967029 |
| Molecular Formula | C17H18N2S2 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | N-[(1S,2R,4S)-7-azabicyclo[2.2.1]heptan-2-yl]-5-phenylthiophene-2-carbothioamide |
| SMILES | S=C(N[C@@H]1C[C@@H]2CC[C@@H]1N2)c1ccc(-c2ccccc2)s1 |
| InChI | InChI=1S/C17H18N2S2/c20-17(19-14-10-12-6-7-13(14)18-12)16-9-8-15(21-16)11-4-2-1-3-5-11/h1-5,8-9,12-14,18H,6-7,10H2,(H,19,20)/t12-,13-,14+/m0/s1 |
| InChIKey | MAKRSGVBMAOKJQ-MELADBBJSA-N |
| XLogP | 3.57 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|