C18H20N2O2S — CID 18535221
N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(3-methylphenoxy)thiophene-2-carboxamide (PubChem CID 18535221) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(3-methylphenoxy)thiophene-2-carboxamide.
| Compound Name | N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(3-methylphenoxy)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 18535221 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(3-methylphenoxy)thiophene-2-carboxamide |
| SMILES | Cc1cccc(Oc2ccc(C(=O)NC3CC4CCC3N4)s2)c1 |
| InChI | InChI=1S/C18H20N2O2S/c1-11-3-2-4-13(9-11)22-17-8-7-16(23-17)18(21)20-15-10-12-5-6-14(15)19-12/h2-4,7-9,12,14-15,19H,5-6,10H2,1H3,(H,20,21) |
| InChIKey | BBPPYRCTUDQFJU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |