C16H16N4O3S — CID 18535437
N-(7-azabicyclo[2.2.1]heptan-2-yl)-2-(3-nitrophenyl)-1,3-thiazole-5-carboxamide (PubChem CID 18535437) has the molecular formula C16H16N4O3S and a molecular weight of 344.40 g/mol. Its IUPAC name is N-(7-azabicyclo[2.2.1]heptan-2-yl)-2-(3-nitrophenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-(7-azabicyclo[2.2.1]heptan-2-yl)-2-(3-nitrophenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 18535437 |
| Molecular Formula | C16H16N4O3S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | N-(7-azabicyclo[2.2.1]heptan-2-yl)-2-(3-nitrophenyl)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NC1CC2CCC1N2)c1cnc(-c2cccc([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C16H16N4O3S/c21-15(19-13-7-10-4-5-12(13)18-10)14-8-17-16(24-14)9-2-1-3-11(6-9)20(22)23/h1-3,6,8,10,12-13,18H,4-5,7H2,(H,19,21) |
| InChIKey | ZDWCLMJYMVINRS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|