C24H28ClF3N4O3 — CID 18536218
4-chloro-2-[2-(dimethylamino)-2-oxoethoxy]-N-[2-[4-[(2,4,5-trifluorophenyl)methyl]piperazin-1-yl]ethyl]benzamide (PubChem CID 18536218) has the molecular formula C24H28ClF3N4O3 and a molecular weight of 512.96 g/mol. Its IUPAC name is 4-chloro-2-[2-(dimethylamino)-2-oxoethoxy]-N-[2-[4-[(2,4,5-trifluorophenyl)methyl]piperazin-1-yl]ethyl]benzamide.
| Compound Name | 4-chloro-2-[2-(dimethylamino)-2-oxoethoxy]-N-[2-[4-[(2,4,5-trifluorophenyl)methyl]piperazin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 18536218 |
| Molecular Formula | C24H28ClF3N4O3 |
| Molecular Weight | 512.96 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | 4-chloro-2-[2-(dimethylamino)-2-oxoethoxy]-N-[2-[4-[(2,4,5-trifluorophenyl)methyl]piperazin-1-yl]ethyl]benzamide |
| SMILES | CN(C)C(=O)COc1cc(Cl)ccc1C(=O)NCCN1CCN(Cc2cc(F)c(F)cc2F)CC1 |
| InChI | InChI=1S/C24H28ClF3N4O3/c1-30(2)23(33)15-35-22-12-17(25)3-4-18(22)24(34)29-5-6-31-7-9-32(10-8-31)14-16-11-20(27)21(28)13-19(16)26/h3-4,11-13H,5-10,14-15H2,1-2H3,(H,29,34) |
| InChIKey | QCOCXZUHJZFIMW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.96 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|