C19H20N2O2S3 — CID 18537201
methyl 5-methylsulfanyl-4-[2-(3-phenylpropylamino)-1,3-thiazol-4-yl]thiophene-2-carboxylate (PubChem CID 18537201) has the molecular formula C19H20N2O2S3 and a molecular weight of 404.58 g/mol. Its IUPAC name is methyl 5-methylsulfanyl-4-[2-(3-phenylpropylamino)-1,3-thiazol-4-yl]thiophene-2-carboxylate.
| Compound Name | methyl 5-methylsulfanyl-4-[2-(3-phenylpropylamino)-1,3-thiazol-4-yl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 18537201 |
| Molecular Formula | C19H20N2O2S3 |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | methyl 5-methylsulfanyl-4-[2-(3-phenylpropylamino)-1,3-thiazol-4-yl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(-c2csc(NCCCc3ccccc3)n2)c(SC)s1 |
| InChI | InChI=1S/C19H20N2O2S3/c1-23-17(22)16-11-14(18(24-2)26-16)15-12-25-19(21-15)20-10-6-9-13-7-4-3-5-8-13/h3-5,7-8,11-12H,6,9-10H2,1-2H3,(H,20,21) |
| InChIKey | MLEUJIRALCLGOE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|